C12H14OS — CID 177018795
(1E)-3-methyl-1-phenyl-2-(sulfanylmethyl)buta-1,3-dien-1-ol (PubChem CID 177018795) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is (1E)-3-methyl-1-phenyl-2-(sulfanylmethyl)buta-1,3-dien-1-ol.
| Compound Name | (1E)-3-methyl-1-phenyl-2-(sulfanylmethyl)buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 177018795 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (1E)-3-methyl-1-phenyl-2-(sulfanylmethyl)buta-1,3-dien-1-ol |
| SMILES | C=C(C)/C(CS)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C12H14OS/c1-9(2)11(8-14)12(13)10-6-4-3-5-7-10/h3-7,13-14H,1,8H2,2H3/b12-11- |
| InChIKey | CJVSEAIWBGRLGT-QXMHVHEDSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|