C13H16O — CID 144607664
[(3Z)-4-methoxy-2-methylpenta-1,3-dien-3-yl]benzene (PubChem CID 144607664) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is [(3Z)-4-methoxy-2-methylpenta-1,3-dien-3-yl]benzene.
| Compound Name | [(3Z)-4-methoxy-2-methylpenta-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 144607664 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [(3Z)-4-methoxy-2-methylpenta-1,3-dien-3-yl]benzene |
| SMILES | C=C(C)/C(=C(\C)OC)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-10(2)13(11(3)14-4)12-8-6-5-7-9-12/h5-9H,1H2,2-4H3/b13-11- |
| InChIKey | RFBUKJBRGVTCGH-QBFSEMIESA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|