C12H13NO — CID 173390067
(2E,4E)-2-phenylhexa-2,4-dienamide (PubChem CID 173390067) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is (2E,4E)-2-phenylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-2-phenylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 173390067 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2E,4E)-2-phenylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C(/C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO/c1-2-3-9-11(12(13)14)10-7-5-4-6-8-10/h2-9H,1H3,(H2,13,14)/b3-2+,11-9+ |
| InChIKey | VPIHFZJNCDIVKY-QDWNBNDKSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|