C14H17N — CID 167165568
(2E,4Z,6Z)-4-phenylocta-2,4,6-trien-3-amine (PubChem CID 167165568) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (2E,4Z,6Z)-4-phenylocta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6Z)-4-phenylocta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 167165568 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2E,4Z,6Z)-4-phenylocta-2,4,6-trien-3-amine |
| SMILES | C/C=C\C=C(C(/N)=C\C)\c1ccccc1 |
| InChI | InChI=1S/C14H17N/c1-3-5-11-13(14(15)4-2)12-9-7-6-8-10-12/h3-11H,15H2,1-2H3/b5-3-,13-11-,14-4+ |
| InChIKey | JIULIIZWLAGJEB-NRMAMTTDSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|