C12H13Br — CID 137396566
1-bromo-3-[(2E,4Z)-hexa-2,4-dien-2-yl]benzene (PubChem CID 137396566) has the molecular formula C12H13Br and a molecular weight of 237.14 g/mol. Its IUPAC name is 1-bromo-3-[(2E,4Z)-hexa-2,4-dien-2-yl]benzene.
| Compound Name | 1-bromo-3-[(2E,4Z)-hexa-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 137396566 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-bromo-3-[(2E,4Z)-hexa-2,4-dien-2-yl]benzene |
| SMILES | C/C=C\C=C(/C)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H13Br/c1-3-4-6-10(2)11-7-5-8-12(13)9-11/h3-9H,1-2H3/b4-3-,10-6+ |
| InChIKey | RJHPWNDMUAKVPI-GEEJUIKGSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|