About 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine
5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine (PubChem CID 139472537) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine.
Molecular Properties
| Compound Name | 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine |
| PubChem CID | 139472537 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine |
| SMILES | C/C=C\C=C(/C)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C16H16N2/c1-3-4-8-13(2)15-11-17-16(18-12-15)14-9-6-5-7-10-14/h3-12H,1-2H3/b4-3-,13-8+ |
| InChIKey | RNXLCKKRXLHBES-RHWWGGFXSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine?
The IUPAC name of 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine (CID 139472537) is 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine.
What is the SMILES notation for 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine?
The canonical SMILES for 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine is C/C=C\C=C(/C)c1cnc(-c2ccccc2)nc1.
What is the InChIKey of 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine?
The InChIKey is RNXLCKKRXLHBES-RHWWGGFXSA-N. The full InChI is InChI=1S/C16H16N2/c1-3-4-8-13(2)15-11-17-16(18-12-15)14-9-6-5-7-10-14/h3-12H,1-2H3/b4-3-,13-8+.
What are the key properties of 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine?
5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine has a molecular weight of 236.32 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-phenylpyrimidine is sourced from PubChem (CID 139472537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).