C20H18N2 — CID 143718934
2-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-phenylquinoxaline (PubChem CID 143718934) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-phenylquinoxaline.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-phenylquinoxaline |
|---|---|
| PubChem CID | 143718934 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-phenylquinoxaline |
| SMILES | C/C=C\C=C(/C)c1nc2ccccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N2/c1-3-4-10-15(2)19-20(16-11-6-5-7-12-16)22-18-14-9-8-13-17(18)21-19/h3-14H,1-2H3/b4-3-,15-10+ |
| InChIKey | MWHAUCKLKDVRTC-LHJSZICDSA-N |
| XLogP | 5.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|