C22H26N2S — CID 145093244
ethane;2-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]thiophen-2-yl]-5-methyl-4-phenyl-1H-imidazole (PubChem CID 145093244) has the molecular formula C22H26N2S and a molecular weight of 350.53 g/mol. Its IUPAC name is ethane;2-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]thiophen-2-yl]-5-methyl-4-phenyl-1H-imidazole.
| Compound Name | ethane;2-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]thiophen-2-yl]-5-methyl-4-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 145093244 |
| Molecular Formula | C22H26N2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethane;2-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]thiophen-2-yl]-5-methyl-4-phenyl-1H-imidazole |
| SMILES | C/C=C\C=C(/C)c1ccc(-c2nc(-c3ccccc3)c(C)[nH]2)s1.CC |
| InChI | InChI=1S/C20H20N2S.C2H6/c1-4-5-9-14(2)17-12-13-18(23-17)20-21-15(3)19(22-20)16-10-7-6-8-11-16;1-2/h4-13H,1-3H3,(H,21,22);1-2H3/b5-4-,14-9+; |
| InChIKey | PVCQQWKQEFREKD-UCQKLEKESA-N |
| XLogP | 7.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|