C22H21FN2 — CID 121391522
2-[(2E,4E)-5-(2-fluorophenyl)hexa-2,4-dien-2-yl]-5-methyl-4-phenyl-1H-imidazole (PubChem CID 121391522) has the molecular formula C22H21FN2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[(2E,4E)-5-(2-fluorophenyl)hexa-2,4-dien-2-yl]-5-methyl-4-phenyl-1H-imidazole.
| Compound Name | 2-[(2E,4E)-5-(2-fluorophenyl)hexa-2,4-dien-2-yl]-5-methyl-4-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 121391522 |
| Molecular Formula | C22H21FN2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[(2E,4E)-5-(2-fluorophenyl)hexa-2,4-dien-2-yl]-5-methyl-4-phenyl-1H-imidazole |
| SMILES | C/C(=C\C=C(/C)c1ccccc1F)c1nc(-c2ccccc2)c(C)[nH]1 |
| InChI | InChI=1S/C22H21FN2/c1-15(19-11-7-8-12-20(19)23)13-14-16(2)22-24-17(3)21(25-22)18-9-5-4-6-10-18/h4-14H,1-3H3,(H,24,25)/b15-13+,16-14+ |
| InChIKey | MCTFDPUZPQANGQ-WXUKJITCSA-N |
| XLogP | 6.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|