C12H9F3N2O2 — CID 141349982
5-methyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazole-2-carboxylic acid (PubChem CID 141349982) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 5-methyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazole-2-carboxylic acid.
| Compound Name | 5-methyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 141349982 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-methyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazole-2-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)O)nc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F3N2O2/c1-6-9(17-10(16-6)11(18)19)7-2-4-8(5-3-7)12(13,14)15/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | YULDVLRJGBFVDL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |