C41H26N6 — CID 59806454
2-[7-[3-(2-isocyanophenyl)-2-phenylquinoxalin-6-yl]-3-[(2E)-penta-2,4-dien-2-yl]quinoxalin-2-yl]benzonitrile (PubChem CID 59806454) has the molecular formula C41H26N6 and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[7-[3-(2-isocyanophenyl)-2-phenylquinoxalin-6-yl]-3-[(2E)-penta-2,4-dien-2-yl]quinoxalin-2-yl]benzonitrile.
| Compound Name | 2-[7-[3-(2-isocyanophenyl)-2-phenylquinoxalin-6-yl]-3-[(2E)-penta-2,4-dien-2-yl]quinoxalin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 59806454 |
| Molecular Formula | C41H26N6 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 2-[7-[3-(2-isocyanophenyl)-2-phenylquinoxalin-6-yl]-3-[(2E)-penta-2,4-dien-2-yl]quinoxalin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1nc2cc(-c3ccc4nc(/C(C)=C/C=C)c(-c5ccccc5C#N)nc4c3)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C41H26N6/c1-4-12-26(2)38-40(31-16-9-8-15-30(31)25-42)46-36-23-28(19-21-34(36)44-38)29-20-22-35-37(24-29)47-41(32-17-10-11-18-33(32)43-3)39(45-35)27-13-6-5-7-14-27/h4-24H,1H2,2H3/b26-12+ |
| InChIKey | IDHPDQAQBVDJBO-RPPGKUMJSA-N |
| XLogP | 10.25 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|