C41H23N5O — CID 140963201
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanophenyl)dibenzofuran-2-yl]benzonitrile (PubChem CID 140963201) has the molecular formula C41H23N5O and a molecular weight of 601.67 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanophenyl)dibenzofuran-2-yl]benzonitrile.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanophenyl)dibenzofuran-2-yl]benzonitrile |
|---|---|
| PubChem CID | 140963201 |
| Molecular Formula | C41H23N5O |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanophenyl)dibenzofuran-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2ccccc2C#N)cc2c1oc1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C41H23N5O/c1-43-36-19-11-10-18-32(36)34-22-30(31-17-9-8-16-29(31)25-42)23-35-33-21-20-28(24-37(33)47-38(34)35)41-45-39(26-12-4-2-5-13-26)44-40(46-41)27-14-6-3-7-15-27/h2-24H |
| InChIKey | PCWJPQBNDDSYFU-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 79.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|