C20H20 — CID 123186746
5-hexa-2,4-dien-2-ylbenzo[10]annulene (PubChem CID 123186746) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-hexa-2,4-dien-2-ylbenzo[10]annulene.
| Compound Name | 5-hexa-2,4-dien-2-ylbenzo[10]annulene |
|---|---|
| PubChem CID | 123186746 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5-hexa-2,4-dien-2-ylbenzo[10]annulene |
| SMILES | CC=CC=C(C)c1cccccccc2ccccc12 |
| InChI | InChI=1S/C20H20/c1-3-4-12-17(2)19-15-9-7-5-6-8-13-18-14-10-11-16-20(18)19/h3-16H,1-2H3/b4-3?,6-5-,7-5-,8-6+,9-7-,13-8+,15-9+,17-12?,18-13-,19-15+,20-19+ |
| InChIKey | LPOHEMDLLVTRKP-KOMSJXMDSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|