C30H30 — CID 123191110
8,9-bis(ethenyl)-12-hexa-2,4-dien-2-yl-5-hexa-1,3,5-trien-2-ylbenzo[10]annulene (PubChem CID 123191110) has the molecular formula C30H30 and a molecular weight of 390.57 g/mol. Its IUPAC name is 8,9-bis(ethenyl)-12-hexa-2,4-dien-2-yl-5-hexa-1,3,5-trien-2-ylbenzo[10]annulene.
| Compound Name | 8,9-bis(ethenyl)-12-hexa-2,4-dien-2-yl-5-hexa-1,3,5-trien-2-ylbenzo[10]annulene |
|---|---|
| PubChem CID | 123191110 |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 8,9-bis(ethenyl)-12-hexa-2,4-dien-2-yl-5-hexa-1,3,5-trien-2-ylbenzo[10]annulene |
| SMILES | C=CC=CC(=C)c1ccc(C=C)c(C=C)ccc(C(C)=CC=CC)c2ccccc12 |
| InChI | InChI=1S/C30H30/c1-7-11-15-23(5)27-21-19-25(9-3)26(10-4)20-22-28(24(6)16-12-8-2)30-18-14-13-17-29(27)30/h7-22H,1,3-5H2,2,6H3/b12-8?,15-11?,21-19+,22-20+,24-16?,25-19-,26-20-,26-25-,27-21+,28-22+,29-27+,30-28+ |
| InChIKey | LDELKJNZQMKVSP-VEJRAIGXSA-N |
| XLogP | 8.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|