C21H21N — CID 59889814
N-[(3E,5Z,7E)-nona-1,3,5,7-tetraen-5-yl]-N-phenylaniline (PubChem CID 59889814) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[(3E,5Z,7E)-nona-1,3,5,7-tetraen-5-yl]-N-phenylaniline.
| Compound Name | N-[(3E,5Z,7E)-nona-1,3,5,7-tetraen-5-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 59889814 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(3E,5Z,7E)-nona-1,3,5,7-tetraen-5-yl]-N-phenylaniline |
| SMILES | C=C/C=C/C(=C/C=C/C)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N/c1-3-5-13-19(14-6-4-2)22(20-15-9-7-10-16-20)21-17-11-8-12-18-21/h3-18H,1H2,2H3/b6-4+,13-5+,19-14- |
| InChIKey | BGKSSKDEZPFOBM-YTZSHANFSA-N |
| XLogP | 6.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|