C20H23P — CID 156713969
[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-phenylphosphane (PubChem CID 156713969) has the molecular formula C20H23P and a molecular weight of 294.38 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-phenylphosphane.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-phenylphosphane |
|---|---|
| PubChem CID | 156713969 |
| Molecular Formula | C20H23P |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-phenylphosphane |
| SMILES | C=C/C=C\C(=C/C)P(/C(C=C)=C/C=C\C)c1ccccc1 |
| InChI | InChI=1S/C20H23P/c1-5-9-14-18(7-3)21(19(8-4)15-10-6-2)20-16-12-11-13-17-20/h5-17H,1,4H2,2-3H3/b10-6-,14-9-,18-7+,19-15+ |
| InChIKey | VIANMGVXIJOESW-LLIWYSQSSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|