C15H19P — CID 143802887
methyl-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-phenylphosphane (PubChem CID 143802887) has the molecular formula C15H19P and a molecular weight of 230.29 g/mol. Its IUPAC name is methyl-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-phenylphosphane.
| Compound Name | methyl-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-phenylphosphane |
|---|---|
| PubChem CID | 143802887 |
| Molecular Formula | C15H19P |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-phenylphosphane |
| SMILES | C/C=C\C(=C/C=C/C)P(C)c1ccccc1 |
| InChI | InChI=1S/C15H19P/c1-4-6-11-14(10-5-2)16(3)15-12-8-7-9-13-15/h4-13H,1-3H3/b6-4+,10-5-,14-11+ |
| InChIKey | FTPQUCQCTRVDSQ-HOAFCLOLSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|