C15H20S — CID 142853593
ethane;(1E,3Z,5E)-1-phenylhepta-1,3,5-triene-3-thiol (PubChem CID 142853593) has the molecular formula C15H20S and a molecular weight of 232.39 g/mol. Its IUPAC name is ethane;(1E,3Z,5E)-1-phenylhepta-1,3,5-triene-3-thiol.
| Compound Name | ethane;(1E,3Z,5E)-1-phenylhepta-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 142853593 |
| Molecular Formula | C15H20S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | ethane;(1E,3Z,5E)-1-phenylhepta-1,3,5-triene-3-thiol |
| SMILES | C/C=C/C=C(S)/C=C/c1ccccc1.CC |
| InChI | InChI=1S/C13H14S.C2H6/c1-2-3-9-13(14)11-10-12-7-5-4-6-8-12;1-2/h2-11,14H,1H3;1-2H3/b3-2+,11-10+,13-9-; |
| InChIKey | MSGFXMDKSSZBGL-HRMVZVCOSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|