C11H13NSe — CID 11096649
(E)-N,N-dimethyl-3-phenylprop-2-eneselenoamide (PubChem CID 11096649) has the molecular formula C11H13NSe and a molecular weight of 238.19 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-phenylprop-2-eneselenoamide.
| Compound Name | (E)-N,N-dimethyl-3-phenylprop-2-eneselenoamide |
|---|---|
| PubChem CID | 11096649 |
| Molecular Formula | C11H13NSe |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | (E)-N,N-dimethyl-3-phenylprop-2-eneselenoamide |
| SMILES | CN(C)C(=[Se])/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H13NSe/c1-12(2)11(13)9-8-10-6-4-3-5-7-10/h3-9H,1-2H3/b9-8+ |
| InChIKey | ZRTVNSQCVZXLAZ-CMDGGOBGSA-N |
| XLogP | 1.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|