C17H18N2Se — CID 11267471
(E)-3-(dimethylamino)-N,N-diphenylprop-2-eneselenoamide (PubChem CID 11267471) has the molecular formula C17H18N2Se and a molecular weight of 329.31 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-N,N-diphenylprop-2-eneselenoamide.
| Compound Name | (E)-3-(dimethylamino)-N,N-diphenylprop-2-eneselenoamide |
|---|---|
| PubChem CID | 11267471 |
| Molecular Formula | C17H18N2Se |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (E)-3-(dimethylamino)-N,N-diphenylprop-2-eneselenoamide |
| SMILES | CN(C)/C=C/C(=[Se])N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2Se/c1-18(2)14-13-17(20)19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14H,1-2H3/b14-13+ |
| InChIKey | DVIJGZFIXARDHZ-BUHFOSPRSA-N |
| XLogP | 3.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|