C19H20N2O — CID 3775115
1,5-bis(N-methylanilino)penta-1,4-dien-3-one (PubChem CID 3775115) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 1,5-bis(N-methylanilino)penta-1,4-dien-3-one.
| Compound Name | 1,5-bis(N-methylanilino)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 3775115 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1,5-bis(N-methylanilino)penta-1,4-dien-3-one |
| SMILES | CN(C=CC(=O)C=CN(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-20(17-9-5-3-6-10-17)15-13-19(22)14-16-21(2)18-11-7-4-8-12-18/h3-16H,1-2H3 |
| InChIKey | NUVAMSHMRMOLFM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|