About formic acid;methyl(phenyl)carbamic acid
formic acid;methyl(phenyl)carbamic acid (PubChem CID 161284118) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is formic acid;methyl(phenyl)carbamic acid.
Molecular Properties
| Compound Name | formic acid;methyl(phenyl)carbamic acid |
| PubChem CID | 161284118 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | formic acid;methyl(phenyl)carbamic acid |
| SMILES | CN(C(=O)O)c1ccccc1.O=CO |
| InChI | InChI=1S/C8H9NO2.CH2O2/c1-9(8(10)11)7-5-3-2-4-6-7;2-1-3/h2-6H,1H3,(H,10,11);1H,(H,2,3) |
| InChIKey | VFMHWIOZPSKMLP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;methyl(phenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;methyl(phenyl)carbamic acid?
The IUPAC name of formic acid;methyl(phenyl)carbamic acid (CID 161284118) is formic acid;methyl(phenyl)carbamic acid.
What is the SMILES notation for formic acid;methyl(phenyl)carbamic acid?
The canonical SMILES for formic acid;methyl(phenyl)carbamic acid is CN(C(=O)O)c1ccccc1.O=CO.
What is the InChIKey of formic acid;methyl(phenyl)carbamic acid?
The InChIKey is VFMHWIOZPSKMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.CH2O2/c1-9(8(10)11)7-5-3-2-4-6-7;2-1-3/h2-6H,1H3,(H,10,11);1H,(H,2,3).
What are the key properties of formic acid;methyl(phenyl)carbamic acid?
formic acid;methyl(phenyl)carbamic acid has a molecular weight of 197.19 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;methyl(phenyl)carbamic acid is sourced from PubChem (CID 161284118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).