C11H11NO — CID 12773177
N-methyl-N-phenylbuta-2,3-dienamide (PubChem CID 12773177) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is N-methyl-N-phenylbuta-2,3-dienamide.
| Compound Name | N-methyl-N-phenylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 12773177 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N-methyl-N-phenylbuta-2,3-dienamide |
| SMILES | C=C=CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C11H11NO/c1-3-7-11(13)12(2)10-8-5-4-6-9-10/h4-9H,1H2,2H3 |
| InChIKey | ITHMKGONFSUPDY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|