C11H13N3O — CID 102316457
1-(cyanomethyl)-1,3-dimethyl-3-phenylurea (PubChem CID 102316457) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(cyanomethyl)-1,3-dimethyl-3-phenylurea.
| Compound Name | 1-(cyanomethyl)-1,3-dimethyl-3-phenylurea |
|---|---|
| PubChem CID | 102316457 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(cyanomethyl)-1,3-dimethyl-3-phenylurea |
| SMILES | CN(CC#N)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c1-13(9-8-12)11(15)14(2)10-6-4-3-5-7-10/h3-7H,9H2,1-2H3 |
| InChIKey | SWEYNNNFKHKOLE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|