C19H22N2O2S — CID 51682775
3-(dimethylamino)-N,N-bis(4-methoxyphenyl)prop-2-enethioamide (PubChem CID 51682775) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 3-(dimethylamino)-N,N-bis(4-methoxyphenyl)prop-2-enethioamide.
| Compound Name | 3-(dimethylamino)-N,N-bis(4-methoxyphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 51682775 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-(dimethylamino)-N,N-bis(4-methoxyphenyl)prop-2-enethioamide |
| SMILES | COc1ccc(N(C(=S)C=CN(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-20(2)14-13-19(24)21(15-5-9-17(22-3)10-6-15)16-7-11-18(23-4)12-8-16/h5-14H,1-4H3 |
| InChIKey | BDTXOAUVWGJRBY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|