C13H10KNS2 — CID 23672385
potassium N,N-diphenylcarbamodithioate (PubChem CID 23672385) has the molecular formula C13H10KNS2 and a molecular weight of 283.46 g/mol. Its IUPAC name is potassium N,N-diphenylcarbamodithioate.
| Compound Name | potassium N,N-diphenylcarbamodithioate |
|---|---|
| PubChem CID | 23672385 |
| Molecular Formula | C13H10KNS2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | potassium N,N-diphenylcarbamodithioate |
| SMILES | S=C([S-])N(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C13H11NS2.K/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H,15,16);/q;+1/p-1 |
| InChIKey | FSSKPSVRKSLRDX-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|