About O-methyl N-amino-N-phenylcarbamothioate;hydroiodide
O-methyl N-amino-N-phenylcarbamothioate;hydroiodide (PubChem CID 87761740) has the molecular formula C8H11IN2OS
and a molecular weight of 310.16 g/mol. Its IUPAC name is O-methyl N-amino-N-phenylcarbamothioate;hydroiodide.
Molecular Properties
| Compound Name | O-methyl N-amino-N-phenylcarbamothioate;hydroiodide |
| PubChem CID | 87761740 |
| Molecular Formula | C8H11IN2OS |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | O-methyl N-amino-N-phenylcarbamothioate;hydroiodide |
| SMILES | COC(=S)N(N)c1ccccc1.I |
| InChI | InChI=1S/C8H10N2OS.HI/c1-11-8(12)10(9)7-5-3-2-4-6-7;/h2-6H,9H2,1H3;1H |
| InChIKey | PEDJZBDZZNFUDN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-amino-N-phenylcarbamothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-amino-N-phenylcarbamothioate;hydroiodide?
The IUPAC name of O-methyl N-amino-N-phenylcarbamothioate;hydroiodide (CID 87761740) is O-methyl N-amino-N-phenylcarbamothioate;hydroiodide.
What is the SMILES notation for O-methyl N-amino-N-phenylcarbamothioate;hydroiodide?
The canonical SMILES for O-methyl N-amino-N-phenylcarbamothioate;hydroiodide is COC(=S)N(N)c1ccccc1.I.
What is the InChIKey of O-methyl N-amino-N-phenylcarbamothioate;hydroiodide?
The InChIKey is PEDJZBDZZNFUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS.HI/c1-11-8(12)10(9)7-5-3-2-4-6-7;/h2-6H,9H2,1H3;1H.
What are the key properties of O-methyl N-amino-N-phenylcarbamothioate;hydroiodide?
O-methyl N-amino-N-phenylcarbamothioate;hydroiodide has a molecular weight of 310.16 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-amino-N-phenylcarbamothioate;hydroiodide is sourced from PubChem (CID 87761740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).