About N-phenylpropanehydrazide
N-phenylpropanehydrazide (PubChem CID 18522904) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is N-phenylpropanehydrazide.
Molecular Properties
| Compound Name | N-phenylpropanehydrazide |
| PubChem CID | 18522904 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-phenylpropanehydrazide |
| SMILES | CCC(=O)N(N)c1ccccc1 |
| InChI | InChI=1S/C9H12N2O/c1-2-9(12)11(10)8-6-4-3-5-7-8/h3-7H,2,10H2,1H3 |
| InChIKey | JWFGERXJODLOFN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-phenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylpropanehydrazide?
The IUPAC name of N-phenylpropanehydrazide (CID 18522904) is N-phenylpropanehydrazide.
What is the SMILES notation for N-phenylpropanehydrazide?
The canonical SMILES for N-phenylpropanehydrazide is CCC(=O)N(N)c1ccccc1.
What is the InChIKey of N-phenylpropanehydrazide?
The InChIKey is JWFGERXJODLOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-9(12)11(10)8-6-4-3-5-7-8/h3-7H,2,10H2,1H3.
What are the key properties of N-phenylpropanehydrazide?
N-phenylpropanehydrazide has a molecular weight of 164.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylpropanehydrazide is sourced from PubChem (CID 18522904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).