C17H28N2O2 — CID 23192818
N-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide (PubChem CID 23192818) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 23192818 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
| SMILES | CCC(=O)N(N)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-8-14(20)19(18)11-9-12(16(2,3)4)15(21)13(10-11)17(5,6)7/h9-10,21H,8,18H2,1-7H3 |
| InChIKey | RNAAEMFAYHFIIF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|