C17H28N2O2S — CID 54325320
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]acetohydrazide (PubChem CID 54325320) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]acetohydrazide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 54325320 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]acetohydrazide |
| SMILES | CC(=O)N(N)SCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O2S/c1-11(20)19(18)22-10-12-8-13(16(2,3)4)15(21)14(9-12)17(5,6)7/h8-9,21H,10,18H2,1-7H3 |
| InChIKey | SUMQNHNPMGVNDG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|