About methyl acetate;1-methyl-1-phenylhydrazine
methyl acetate;1-methyl-1-phenylhydrazine (PubChem CID 90706381) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl acetate;1-methyl-1-phenylhydrazine.
Molecular Properties
| Compound Name | methyl acetate;1-methyl-1-phenylhydrazine |
| PubChem CID | 90706381 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | methyl acetate;1-methyl-1-phenylhydrazine |
| SMILES | CN(N)c1ccccc1.COC(C)=O |
| InChI | InChI=1S/C7H10N2.C3H6O2/c1-9(8)7-5-3-2-4-6-7;1-3(4)5-2/h2-6H,8H2,1H3;1-2H3 |
| InChIKey | CHWMUUBPFHQWTN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl acetate;1-methyl-1-phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;1-methyl-1-phenylhydrazine?
The IUPAC name of methyl acetate;1-methyl-1-phenylhydrazine (CID 90706381) is methyl acetate;1-methyl-1-phenylhydrazine.
What is the SMILES notation for methyl acetate;1-methyl-1-phenylhydrazine?
The canonical SMILES for methyl acetate;1-methyl-1-phenylhydrazine is CN(N)c1ccccc1.COC(C)=O.
What is the InChIKey of methyl acetate;1-methyl-1-phenylhydrazine?
The InChIKey is CHWMUUBPFHQWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C3H6O2/c1-9(8)7-5-3-2-4-6-7;1-3(4)5-2/h2-6H,8H2,1H3;1-2H3.
What are the key properties of methyl acetate;1-methyl-1-phenylhydrazine?
methyl acetate;1-methyl-1-phenylhydrazine has a molecular weight of 196.25 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;1-methyl-1-phenylhydrazine is sourced from PubChem (CID 90706381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).