About (N-methylanilino) carbamate
(N-methylanilino) carbamate (PubChem CID 175107700) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is (N-methylanilino) carbamate.
Molecular Properties
| Compound Name | (N-methylanilino) carbamate |
| PubChem CID | 175107700 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (N-methylanilino) carbamate |
| SMILES | CN(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C8H10N2O2/c1-10(12-8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| InChIKey | ZBUZVNNHAYATQP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-methylanilino) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-methylanilino) carbamate?
The IUPAC name of (N-methylanilino) carbamate (CID 175107700) is (N-methylanilino) carbamate.
What is the SMILES notation for (N-methylanilino) carbamate?
The canonical SMILES for (N-methylanilino) carbamate is CN(OC(N)=O)c1ccccc1.
What is the InChIKey of (N-methylanilino) carbamate?
The InChIKey is ZBUZVNNHAYATQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-10(12-8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11).
What are the key properties of (N-methylanilino) carbamate?
(N-methylanilino) carbamate has a molecular weight of 166.18 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (N-methylanilino) carbamate is sourced from PubChem (CID 175107700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).