C9H8F3NO — CID 87396734
N-methyl-N-(1,2,2-trifluoroethenoxy)aniline (PubChem CID 87396734) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is N-methyl-N-(1,2,2-trifluoroethenoxy)aniline.
| Compound Name | N-methyl-N-(1,2,2-trifluoroethenoxy)aniline |
|---|---|
| PubChem CID | 87396734 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | N-methyl-N-(1,2,2-trifluoroethenoxy)aniline |
| SMILES | CN(OC(F)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H8F3NO/c1-13(14-9(12)8(10)11)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | HKYMUWHKAZLIAX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|