About copper;(N-methylanilino) acetate
copper;(N-methylanilino) acetate (PubChem CID 88782119) has the molecular formula C9H11CuNO2
and a molecular weight of 228.74 g/mol. Its IUPAC name is copper;(N-methylanilino) acetate.
Molecular Properties
| Compound Name | copper;(N-methylanilino) acetate |
| PubChem CID | 88782119 |
| Molecular Formula | C9H11CuNO2 |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | copper;(N-methylanilino) acetate |
| SMILES | CC(=O)ON(C)c1ccccc1.[Cu] |
| InChI | InChI=1S/C9H11NO2.Cu/c1-8(11)12-10(2)9-6-4-3-5-7-9;/h3-7H,1-2H3; |
| InChIKey | KVVBNYQUMMQMBX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;(N-methylanilino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(N-methylanilino) acetate?
The IUPAC name of copper;(N-methylanilino) acetate (CID 88782119) is copper;(N-methylanilino) acetate.
What is the SMILES notation for copper;(N-methylanilino) acetate?
The canonical SMILES for copper;(N-methylanilino) acetate is CC(=O)ON(C)c1ccccc1.[Cu].
What is the InChIKey of copper;(N-methylanilino) acetate?
The InChIKey is KVVBNYQUMMQMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.Cu/c1-8(11)12-10(2)9-6-4-3-5-7-9;/h3-7H,1-2H3;.
What are the key properties of copper;(N-methylanilino) acetate?
copper;(N-methylanilino) acetate has a molecular weight of 228.74 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(N-methylanilino) acetate is sourced from PubChem (CID 88782119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).