About [acetyl(benzyl)amino] acetate
[acetyl(benzyl)amino] acetate (PubChem CID 131850460) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is [acetyl(benzyl)amino] acetate.
Molecular Properties
| Compound Name | [acetyl(benzyl)amino] acetate |
| PubChem CID | 131850460 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [acetyl(benzyl)amino] acetate |
| SMILES | CC(=O)ON(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C11H13NO3/c1-9(13)12(15-10(2)14)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | UIMYYKLBQLMOEN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [acetyl(benzyl)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyl(benzyl)amino] acetate?
The IUPAC name of [acetyl(benzyl)amino] acetate (CID 131850460) is [acetyl(benzyl)amino] acetate.
What is the SMILES notation for [acetyl(benzyl)amino] acetate?
The canonical SMILES for [acetyl(benzyl)amino] acetate is CC(=O)ON(Cc1ccccc1)C(C)=O.
What is the InChIKey of [acetyl(benzyl)amino] acetate?
The InChIKey is UIMYYKLBQLMOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-9(13)12(15-10(2)14)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3.
What are the key properties of [acetyl(benzyl)amino] acetate?
[acetyl(benzyl)amino] acetate has a molecular weight of 207.23 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyl(benzyl)amino] acetate is sourced from PubChem (CID 131850460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).