About benzyl(bromo)carbamic acid
benzyl(bromo)carbamic acid (PubChem CID 87217964) has the molecular formula C8H8BrNO2
and a molecular weight of 230.06 g/mol. Its IUPAC name is benzyl(bromo)carbamic acid.
Molecular Properties
| Compound Name | benzyl(bromo)carbamic acid |
| PubChem CID | 87217964 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | benzyl(bromo)carbamic acid |
| SMILES | O=C(O)N(Br)Cc1ccccc1 |
| InChI | InChI=1S/C8H8BrNO2/c9-10(8(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| InChIKey | PQSNQZPYPMTEDC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze benzyl(bromo)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(bromo)carbamic acid?
The IUPAC name of benzyl(bromo)carbamic acid (CID 87217964) is benzyl(bromo)carbamic acid.
What is the SMILES notation for benzyl(bromo)carbamic acid?
The canonical SMILES for benzyl(bromo)carbamic acid is O=C(O)N(Br)Cc1ccccc1.
What is the InChIKey of benzyl(bromo)carbamic acid?
The InChIKey is PQSNQZPYPMTEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c9-10(8(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12).
What are the key properties of benzyl(bromo)carbamic acid?
benzyl(bromo)carbamic acid has a molecular weight of 230.06 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(bromo)carbamic acid is sourced from PubChem (CID 87217964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).