About 2-hydroxybenzoic acid;methyl acetate
2-hydroxybenzoic acid;methyl acetate (PubChem CID 157381538) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;methyl acetate.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;methyl acetate |
| PubChem CID | 157381538 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-hydroxybenzoic acid;methyl acetate |
| SMILES | COC(C)=O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C3H6O2/c8-6-4-2-1-3-5(6)7(9)10;1-3(4)5-2/h1-4,8H,(H,9,10);1-2H3 |
| InChIKey | BKYBBZXFFJPUNH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;methyl acetate?
The IUPAC name of 2-hydroxybenzoic acid;methyl acetate (CID 157381538) is 2-hydroxybenzoic acid;methyl acetate.
What is the SMILES notation for 2-hydroxybenzoic acid;methyl acetate?
The canonical SMILES for 2-hydroxybenzoic acid;methyl acetate is COC(C)=O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;methyl acetate?
The InChIKey is BKYBBZXFFJPUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C3H6O2/c8-6-4-2-1-3-5(6)7(9)10;1-3(4)5-2/h1-4,8H,(H,9,10);1-2H3.
What are the key properties of 2-hydroxybenzoic acid;methyl acetate?
2-hydroxybenzoic acid;methyl acetate has a molecular weight of 212.20 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;methyl acetate is sourced from PubChem (CID 157381538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).