C12H16N2 — CID 163586551
1-[(2Z)-4-methylpenta-2,4-dien-2-yl]-1-phenylhydrazine (PubChem CID 163586551) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]-1-phenylhydrazine.
| Compound Name | 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]-1-phenylhydrazine |
|---|---|
| PubChem CID | 163586551 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]-1-phenylhydrazine |
| SMILES | C=C(C)/C=C(/C)N(N)c1ccccc1 |
| InChI | InChI=1S/C12H16N2/c1-10(2)9-11(3)14(13)12-7-5-4-6-8-12/h4-9H,1,13H2,2-3H3/b11-9- |
| InChIKey | GLYZYPWQZQCGBI-LUAWRHEFSA-N |
| XLogP | 2.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|