C15H18N6S2 — CID 143179510
1-(N-aminoanilino)ethenylsulfanyl N,N'-diamino-N-phenylcarbamimidothioate (PubChem CID 143179510) has the molecular formula C15H18N6S2 and a molecular weight of 346.49 g/mol. Its IUPAC name is 1-(N-aminoanilino)ethenylsulfanyl N,N'-diamino-N-phenylcarbamimidothioate.
| Compound Name | 1-(N-aminoanilino)ethenylsulfanyl N,N'-diamino-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 143179510 |
| Molecular Formula | C15H18N6S2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(N-aminoanilino)ethenylsulfanyl N,N'-diamino-N-phenylcarbamimidothioate |
| SMILES | C=C(SS/C(=N/N)N(N)c1ccccc1)N(N)c1ccccc1 |
| InChI | InChI=1S/C15H18N6S2/c1-12(20(17)13-8-4-2-5-9-13)22-23-15(19-16)21(18)14-10-6-3-7-11-14/h2-11H,1,16-18H2/b19-15+ |
| InChIKey | SXVYAYKTNDECSU-XDJHFCHBSA-N |
| XLogP | 2.83 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|