C18H20N6O4S — CID 145176562
[4-(N-formyl-4-nitroanilino)-4-oxobutan-2-yl] N,N'-diamino-N-phenylcarbamimidothioate (PubChem CID 145176562) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is [4-(N-formyl-4-nitroanilino)-4-oxobutan-2-yl] N,N'-diamino-N-phenylcarbamimidothioate.
| Compound Name | [4-(N-formyl-4-nitroanilino)-4-oxobutan-2-yl] N,N'-diamino-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 145176562 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [4-(N-formyl-4-nitroanilino)-4-oxobutan-2-yl] N,N'-diamino-N-phenylcarbamimidothioate |
| SMILES | CC(CC(=O)N(C=O)c1ccc([N+](=O)[O-])cc1)S/C(=N/N)N(N)c1ccccc1 |
| InChI | InChI=1S/C18H20N6O4S/c1-13(29-18(21-19)23(20)15-5-3-2-4-6-15)11-17(26)22(12-25)14-7-9-16(10-8-14)24(27)28/h2-10,12-13H,11,19-20H2,1H3/b21-18+ |
| InChIKey | VQLSDKKQSNPFRE-DYTRJAOYSA-N |
| XLogP | 2.21 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|