C13H10NNaOS — CID 142702473
sodium N,N-diphenylcarbamothioate (PubChem CID 142702473) has the molecular formula C13H10NNaOS and a molecular weight of 251.29 g/mol. Its IUPAC name is sodium N,N-diphenylcarbamothioate.
| Compound Name | sodium N,N-diphenylcarbamothioate |
|---|---|
| PubChem CID | 142702473 |
| Molecular Formula | C13H10NNaOS |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | sodium N,N-diphenylcarbamothioate |
| SMILES | [Na+].[O-]C(=S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11NOS.Na/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H,15,16);/q;+1/p-1 |
| InChIKey | CDYMOOLWEGJPGN-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|