C13H7F3NO2- — CID 156594025
N-phenyl-N-(3,4,5-trifluorophenyl)carbamate (PubChem CID 156594025) has the molecular formula C13H7F3NO2- and a molecular weight of 266.20 g/mol. Its IUPAC name is N-phenyl-N-(3,4,5-trifluorophenyl)carbamate.
| Compound Name | N-phenyl-N-(3,4,5-trifluorophenyl)carbamate |
|---|---|
| PubChem CID | 156594025 |
| Molecular Formula | C13H7F3NO2- |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-phenyl-N-(3,4,5-trifluorophenyl)carbamate |
| SMILES | O=C([O-])N(c1ccccc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H8F3NO2/c14-10-6-9(7-11(15)12(10)16)17(13(18)19)8-4-2-1-3-5-8/h1-7H,(H,18,19)/p-1 |
| InChIKey | NMEUREVYMOFWJF-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|