C21H30IN2O3- — CID 23623397
N,N-diphenylcarbamate;triethyl(2-hydroxyethyl)azanium;iodide (PubChem CID 23623397) has the molecular formula C21H30IN2O3- and a molecular weight of 485.39 g/mol. Its IUPAC name is N,N-diphenylcarbamate;triethyl(2-hydroxyethyl)azanium;iodide.
| Compound Name | N,N-diphenylcarbamate;triethyl(2-hydroxyethyl)azanium;iodide |
|---|---|
| PubChem CID | 23623397 |
| Molecular Formula | C21H30IN2O3- |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N,N-diphenylcarbamate;triethyl(2-hydroxyethyl)azanium;iodide |
| SMILES | CC[N+](CC)(CC)CCO.O=C([O-])N(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C13H11NO2.C8H20NO.HI/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-9(5-2,6-3)7-8-10;/h1-10H,(H,15,16);10H,4-8H2,1-3H3;1H/q;+1;/p-2 |
| InChIKey | XFPXTNZLOUCGOI-UHFFFAOYSA-L |
| XLogP | 0.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|