About bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide
bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide (PubChem CID 71439210) has the molecular formula C28H47IN2O4
and a molecular weight of 602.60 g/mol. Its IUPAC name is bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide.
Molecular Properties
| Compound Name | bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide |
| PubChem CID | 71439210 |
| Molecular Formula | C28H47IN2O4 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide |
| SMILES | CC[N+](C)(CC)CCO.CC[N+](C)(CC)CCO.O=C([O-])Cc1ccc(-c2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C14H12O2.2C7H18NO.HI/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;2*1-4-8(3,5-2)6-7-9;/h1-9H,10H2,(H,15,16);2*9H,4-7H2,1-3H3;1H/q;2*+1;/p-2 |
| InChIKey | BILBQUAFJOXLBH-UHFFFAOYSA-L |
| XLogP | -0.42 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide?
The IUPAC name of bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide (CID 71439210) is bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide.
What is the SMILES notation for bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide?
The canonical SMILES for bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide is CC[N+](C)(CC)CCO.CC[N+](C)(CC)CCO.O=C([O-])Cc1ccc(-c2ccccc2)cc1.[I-].
What is the InChIKey of bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide?
The InChIKey is BILBQUAFJOXLBH-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H12O2.2C7H18NO.HI/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;2*1-4-8(3,5-2)6-7-9;/h1-9H,10H2,(H,15,16);2*9H,4-7H2,1-3H3;1H/q;2*+1;/p-2.
What are the key properties of bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide?
bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide has a molecular weight of 602.60 g/mol, XLogP of -0.42, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diethyl-(2-hydroxyethyl)-methylazanium);2-(4-phenylphenyl)acetate;iodide is sourced from PubChem (CID 71439210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).