2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid

C18H23NO3 — CID 174946670

IUPAC2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid
SMILESCN(C)CCO.O=C(O)Cc1ccc(-c2ccccc2)cc1
InChIInChI=1S/C14H12O2.C4H11NO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-5(2)3-4-6/h1-9H,10H2,(H,15,16);6H,3-4H2,1-2H3
InChIKeyDGAXZLCSJVLXLW-UHFFFAOYSA-N
MW301.39 g/mol
LogP2.52
Rot. Bonds5

About 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid

2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid (PubChem CID 174946670) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid.

Molecular Properties

Compound Name2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid
PubChem CID174946670
Molecular FormulaC18H23NO3
Molecular Weight301.39 g/mol
Exact Mass301.17
IUPAC Name2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid
SMILESCN(C)CCO.O=C(O)Cc1ccc(-c2ccccc2)cc1
InChIInChI=1S/C14H12O2.C4H11NO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-5(2)3-4-6/h1-9H,10H2,(H,15,16);6H,3-4H2,1-2H3
InChIKeyDGAXZLCSJVLXLW-UHFFFAOYSA-N
XLogP2.52
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.39
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid?
The IUPAC name of 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid (CID 174946670) is 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid.
What is the SMILES notation for 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid?
The canonical SMILES for 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid is CN(C)CCO.O=C(O)Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid?
The InChIKey is DGAXZLCSJVLXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C4H11NO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-5(2)3-4-6/h1-9H,10H2,(H,15,16);6H,3-4H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid?
2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid has a molecular weight of 301.39 g/mol, XLogP of 2.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid is sourced from PubChem (CID 174946670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).