C18H23NO3 — CID 174946670
2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid (PubChem CID 174946670) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid.
| Compound Name | 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid |
|---|---|
| PubChem CID | 174946670 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(dimethylamino)ethanol;2-(4-phenylphenyl)acetic acid |
| SMILES | CN(C)CCO.O=C(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2.C4H11NO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-5(2)3-4-6/h1-9H,10H2,(H,15,16);6H,3-4H2,1-2H3 |
| InChIKey | DGAXZLCSJVLXLW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |