C17H22ClNO3 — CID 86623035
1-aminopropan-1-ol;2-(4-phenylphenyl)acetic acid;hydrochloride (PubChem CID 86623035) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-aminopropan-1-ol;2-(4-phenylphenyl)acetic acid;hydrochloride.
| Compound Name | 1-aminopropan-1-ol;2-(4-phenylphenyl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 86623035 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-aminopropan-1-ol;2-(4-phenylphenyl)acetic acid;hydrochloride |
| SMILES | CCC(N)O.Cl.O=C(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2.C3H9NO.ClH/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-2-3(4)5;/h1-9H,10H2,(H,15,16);3,5H,2,4H2,1H3;1H |
| InChIKey | UAORBQCNBFOUQC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|