About propanoate;triethyl(phenyl)azanium
propanoate;triethyl(phenyl)azanium (PubChem CID 146567529) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is propanoate;triethyl(phenyl)azanium.
Molecular Properties
| Compound Name | propanoate;triethyl(phenyl)azanium |
| PubChem CID | 146567529 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | propanoate;triethyl(phenyl)azanium |
| SMILES | CCC(=O)[O-].CC[N+](CC)(CC)c1ccccc1 |
| InChI | InChI=1S/C12H20N.C3H6O2/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;1-2-3(4)5/h7-11H,4-6H2,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | PZLQCNAKQYOZFZ-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze propanoate;triethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoate;triethyl(phenyl)azanium?
The IUPAC name of propanoate;triethyl(phenyl)azanium (CID 146567529) is propanoate;triethyl(phenyl)azanium.
What is the SMILES notation for propanoate;triethyl(phenyl)azanium?
The canonical SMILES for propanoate;triethyl(phenyl)azanium is CCC(=O)[O-].CC[N+](CC)(CC)c1ccccc1.
What is the InChIKey of propanoate;triethyl(phenyl)azanium?
The InChIKey is PZLQCNAKQYOZFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H20N.C3H6O2/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;1-2-3(4)5/h7-11H,4-6H2,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of propanoate;triethyl(phenyl)azanium?
propanoate;triethyl(phenyl)azanium has a molecular weight of 251.37 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoate;triethyl(phenyl)azanium is sourced from PubChem (CID 146567529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).