C18H28NO7+ — CID 146567455
2-hydroxypropane-1,2,3-tricarboxylic acid;triethyl(phenyl)azanium (PubChem CID 146567455) has the molecular formula C18H28NO7+ and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;triethyl(phenyl)azanium.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;triethyl(phenyl)azanium |
|---|---|
| PubChem CID | 146567455 |
| Molecular Formula | C18H28NO7+ |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;triethyl(phenyl)azanium |
| SMILES | CC[N+](CC)(CC)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N.C6H8O7/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h7-11H,4-6H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/q+1; |
| InChIKey | BZSQOMCRAISYKS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|