About triethyl(phenyl)azanium;hydroxide;hydrofluoride
triethyl(phenyl)azanium;hydroxide;hydrofluoride (PubChem CID 139832069) has the molecular formula C12H22FNO
and a molecular weight of 215.31 g/mol. Its IUPAC name is triethyl(phenyl)azanium;hydroxide;hydrofluoride.
Molecular Properties
| Compound Name | triethyl(phenyl)azanium;hydroxide;hydrofluoride |
| PubChem CID | 139832069 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | triethyl(phenyl)azanium;hydroxide;hydrofluoride |
| SMILES | CC[N+](CC)(CC)c1ccccc1.F.[OH-] |
| InChI | InChI=1S/C12H20N.FH.H2O/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;;/h7-11H,4-6H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | GGMVUINRWLEZDW-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(phenyl)azanium;hydroxide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(phenyl)azanium;hydroxide;hydrofluoride?
The IUPAC name of triethyl(phenyl)azanium;hydroxide;hydrofluoride (CID 139832069) is triethyl(phenyl)azanium;hydroxide;hydrofluoride.
What is the SMILES notation for triethyl(phenyl)azanium;hydroxide;hydrofluoride?
The canonical SMILES for triethyl(phenyl)azanium;hydroxide;hydrofluoride is CC[N+](CC)(CC)c1ccccc1.F.[OH-].
What is the InChIKey of triethyl(phenyl)azanium;hydroxide;hydrofluoride?
The InChIKey is GGMVUINRWLEZDW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H20N.FH.H2O/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;;/h7-11H,4-6H2,1-3H3;1H;1H2/q+1;;/p-1.
What are the key properties of triethyl(phenyl)azanium;hydroxide;hydrofluoride?
triethyl(phenyl)azanium;hydroxide;hydrofluoride has a molecular weight of 215.31 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(phenyl)azanium;hydroxide;hydrofluoride is sourced from PubChem (CID 139832069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).