About oxido(oxo)borane;triethyl(phenyl)azanium
oxido(oxo)borane;triethyl(phenyl)azanium (PubChem CID 14746837) has the molecular formula C12H20BNO2
and a molecular weight of 221.11 g/mol. Its IUPAC name is oxido(oxo)borane;triethyl(phenyl)azanium.
Molecular Properties
| Compound Name | oxido(oxo)borane;triethyl(phenyl)azanium |
| PubChem CID | 14746837 |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | oxido(oxo)borane;triethyl(phenyl)azanium |
| SMILES | CC[N+](CC)(CC)c1ccccc1.O=B[O-] |
| InChI | InChI=1S/C12H20N.BO2/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;2-1-3/h7-11H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | VTRPXNMTZBPWBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxido(oxo)borane;triethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido(oxo)borane;triethyl(phenyl)azanium?
The IUPAC name of oxido(oxo)borane;triethyl(phenyl)azanium (CID 14746837) is oxido(oxo)borane;triethyl(phenyl)azanium.
What is the SMILES notation for oxido(oxo)borane;triethyl(phenyl)azanium?
The canonical SMILES for oxido(oxo)borane;triethyl(phenyl)azanium is CC[N+](CC)(CC)c1ccccc1.O=B[O-].
What is the InChIKey of oxido(oxo)borane;triethyl(phenyl)azanium?
The InChIKey is VTRPXNMTZBPWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.BO2/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;2-1-3/h7-11H,4-6H2,1-3H3;/q+1;-1.
What are the key properties of oxido(oxo)borane;triethyl(phenyl)azanium?
oxido(oxo)borane;triethyl(phenyl)azanium has a molecular weight of 221.11 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxido(oxo)borane;triethyl(phenyl)azanium is sourced from PubChem (CID 14746837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).